C16H23NO — CID 114210068
3-[3-(4,4-dimethylpentoxy)phenyl]prop-2-yn-1-amine (PubChem CID 114210068) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-[3-(4,4-dimethylpentoxy)phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[3-(4,4-dimethylpentoxy)phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 114210068 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-[3-(4,4-dimethylpentoxy)phenyl]prop-2-yn-1-amine |
| SMILES | CC(C)(C)CCCOc1cccc(C#CCN)c1 |
| InChI | InChI=1S/C16H23NO/c1-16(2,3)10-6-12-18-15-9-4-7-14(13-15)8-5-11-17/h4,7,9,13H,6,10-12,17H2,1-3H3 |
| InChIKey | ZMDHEOMCXHQVTO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|