C14H23ClN2O — CID 114210085
6-chloro-3-(4,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one (PubChem CID 114210085) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 6-chloro-3-(4,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one.
| Compound Name | 6-chloro-3-(4,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 114210085 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 6-chloro-3-(4,4-dimethylpentyl)-2-propan-2-ylpyrimidin-4-one |
| SMILES | CC(C)c1nc(Cl)cc(=O)n1CCCC(C)(C)C |
| InChI | InChI=1S/C14H23ClN2O/c1-10(2)13-16-11(15)9-12(18)17(13)8-6-7-14(3,4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | RUMUCCROMLUSSB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |