C16H28N2O — CID 114211443
[1-(2-methoxyphenyl)-6,6-dimethylheptan-2-yl]hydrazine (PubChem CID 114211443) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is [1-(2-methoxyphenyl)-6,6-dimethylheptan-2-yl]hydrazine.
| Compound Name | [1-(2-methoxyphenyl)-6,6-dimethylheptan-2-yl]hydrazine |
|---|---|
| PubChem CID | 114211443 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | [1-(2-methoxyphenyl)-6,6-dimethylheptan-2-yl]hydrazine |
| SMILES | COc1ccccc1CC(CCCC(C)(C)C)NN |
| InChI | InChI=1S/C16H28N2O/c1-16(2,3)11-7-9-14(18-17)12-13-8-5-6-10-15(13)19-4/h5-6,8,10,14,18H,7,9,11-12,17H2,1-4H3 |
| InChIKey | FWWQUMBCRZZTOW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|