C14H18ClNO2 — CID 114211890
N-(1-chloro-4-methoxybutan-2-yl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 114211890) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is N-(1-chloro-4-methoxybutan-2-yl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
| Compound Name | N-(1-chloro-4-methoxybutan-2-yl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
|---|---|
| PubChem CID | 114211890 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(1-chloro-4-methoxybutan-2-yl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| SMILES | COCCC(CCl)NC(=O)C1Cc2ccccc21 |
| InChI | InChI=1S/C14H18ClNO2/c1-18-7-6-11(9-15)16-14(17)13-8-10-4-2-3-5-12(10)13/h2-5,11,13H,6-9H2,1H3,(H,16,17) |
| InChIKey | UPTNPDMMIPLIFX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|