C14H25N3 — CID 114212057
N-[[2-(3,3-dimethylbutyl)pyrimidin-4-yl]methyl]propan-1-amine (PubChem CID 114212057) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[[2-(3,3-dimethylbutyl)pyrimidin-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,3-dimethylbutyl)pyrimidin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114212057 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-[[2-(3,3-dimethylbutyl)pyrimidin-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccnc(CCC(C)(C)C)n1 |
| InChI | InChI=1S/C14H25N3/c1-5-9-15-11-12-7-10-16-13(17-12)6-8-14(2,3)4/h7,10,15H,5-6,8-9,11H2,1-4H3 |
| InChIKey | KLYPQYDEAGOUHW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|