About methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate
methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate (PubChem CID 114212341) has the molecular formula C10H17N3O4S
and a molecular weight of 275.33 g/mol. Its IUPAC name is methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate |
| PubChem CID | 114212341 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate |
| SMILES | COCCC(CO)Nc1snc(N)c1C(=O)OC |
| InChI | InChI=1S/C10H17N3O4S/c1-16-4-3-6(5-14)12-9-7(10(15)17-2)8(11)13-18-9/h6,12,14H,3-5H2,1-2H3,(H2,11,13) |
| InChIKey | DOCBIKCLZHQREE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate?
The IUPAC name of methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate (CID 114212341) is methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate.
What is the SMILES notation for methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate?
The canonical SMILES for methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate is COCCC(CO)Nc1snc(N)c1C(=O)OC.
What is the InChIKey of methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate?
The InChIKey is DOCBIKCLZHQREE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4S/c1-16-4-3-6(5-14)12-9-7(10(15)17-2)8(11)13-18-9/h6,12,14H,3-5H2,1-2H3,(H2,11,13).
What are the key properties of methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate?
methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate has a molecular weight of 275.33 g/mol, XLogP of 0.32, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-5-[(1-hydroxy-4-methoxybutan-2-yl)amino]-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 114212341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).