C31H36O6Si — CID 11421246
5-[[2-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione (PubChem CID 11421246) has the molecular formula C31H36O6Si and a molecular weight of 532.71 g/mol. Its IUPAC name is 5-[[2-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[2-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11421246 |
| Molecular Formula | C31H36O6Si |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 5-[[2-[tert-butyl(diphenyl)silyl]oxy-3-methoxyphenyl]methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cccc(CC2(C)C(=O)OC(C)(C)OC2=O)c1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H36O6Si/c1-29(2,3)38(23-16-10-8-11-17-23,24-18-12-9-13-19-24)37-26-22(15-14-20-25(26)34-7)21-31(6)27(32)35-30(4,5)36-28(31)33/h8-20H,21H2,1-7H3 |
| InChIKey | ITHXHKIRMBQGDL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|