About N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine
N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine (PubChem CID 114213282) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine |
| PubChem CID | 114213282 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine |
| SMILES | CCNC(c1cnnn1CC)C(OC)C(C)(C)C |
| InChI | InChI=1S/C13H26N4O/c1-7-14-11(12(18-6)13(3,4)5)10-9-15-16-17(10)8-2/h9,11-12,14H,7-8H2,1-6H3 |
| InChIKey | JPPRMGKUFDGYCW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine?
The IUPAC name of N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine (CID 114213282) is N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine.
What is the SMILES notation for N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine?
The canonical SMILES for N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine is CCNC(c1cnnn1CC)C(OC)C(C)(C)C.
What is the InChIKey of N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine?
The InChIKey is JPPRMGKUFDGYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O/c1-7-14-11(12(18-6)13(3,4)5)10-9-15-16-17(10)8-2/h9,11-12,14H,7-8H2,1-6H3.
What are the key properties of N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine?
N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine has a molecular weight of 254.38 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-(3-ethyltriazol-4-yl)-2-methoxy-3,3-dimethylbutan-1-amine is sourced from PubChem (CID 114213282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).