C13H20N2O4 — CID 114213685
methyl 2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 114213685) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 114213685 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | methyl 2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(CC)(CC)c1ncc(C(=O)OC)c(=O)[nH]1 |
| InChI | InChI=1S/C13H20N2O4/c1-5-13(6-2,19-7-3)12-14-8-9(10(16)15-12)11(17)18-4/h8H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | RJPRCQOMJJSLJW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |