C25H29IO4Si — CID 11421446
(3aR,4S,7aR)-4-[tert-butyl(diphenyl)silyl]oxy-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one (PubChem CID 11421446) has the molecular formula C25H29IO4Si and a molecular weight of 548.49 g/mol. Its IUPAC name is (3aR,4S,7aR)-4-[tert-butyl(diphenyl)silyl]oxy-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | (3aR,4S,7aR)-4-[tert-butyl(diphenyl)silyl]oxy-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 11421446 |
| Molecular Formula | C25H29IO4Si |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | (3aR,4S,7aR)-4-[tert-butyl(diphenyl)silyl]oxy-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
| SMILES | CC1(C)O[C@H]2[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)C(I)=C[C@H]2O1 |
| InChI | InChI=1S/C25H29IO4Si/c1-24(2,3)31(17-12-8-6-9-13-17,18-14-10-7-11-15-18)30-23-21(27)19(26)16-20-22(23)29-25(4,5)28-20/h6-16,20,22-23H,1-5H3/t20-,22-,23-/m1/s1 |
| InChIKey | CXPOBJHUUFVJMX-YMPZKCBVSA-N |
| XLogP | 4.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|