C26H35N11O3 — CID 11421464
N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-2,3-dihydroxybenzamide (PubChem CID 11421464) has the molecular formula C26H35N11O3 and a molecular weight of 549.64 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 11421464 |
| Molecular Formula | C26H35N11O3 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-2,3-dihydroxybenzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4cccc(O)c4O)cc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H35N11O3/c27-14-8-15(28)11-36(10-14)25-33-24(34-26(35-25)37-12-16(29)9-17(30)13-37)32-19-6-4-18(5-7-19)31-23(40)20-2-1-3-21(38)22(20)39/h1-7,14-17,38-39H,8-13,27-30H2,(H,31,40)(H,32,33,34,35)/t14-,15+,16-,17+ |
| InChIKey | KMDCDFWMSCCRDK-WNKDZCFJSA-N |
| XLogP | 0.01 |
| TPSA | 230.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|