C10H13F2N3O3 — CID 114214850
4-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyrimidine-5-carboxylic acid (PubChem CID 114214850) has the molecular formula C10H13F2N3O3 and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyrimidine-5-carboxylic acid.
| Compound Name | 4-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 114214850 |
| Molecular Formula | C10H13F2N3O3 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyrimidine-5-carboxylic acid |
| SMILES | Cc1ncc(C(=O)O)c(NCCOCC(F)F)n1 |
| InChI | InChI=1S/C10H13F2N3O3/c1-6-14-4-7(10(16)17)9(15-6)13-2-3-18-5-8(11)12/h4,8H,2-3,5H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | MSAALFPUZNWGFL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|