C13H18F2N2O — CID 114215752
(2-amino-4-methyl-3-pyridinyl)-(3,3-difluorocyclohexyl)methanol (PubChem CID 114215752) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is (2-amino-4-methyl-3-pyridinyl)-(3,3-difluorocyclohexyl)methanol.
| Compound Name | (2-amino-4-methyl-3-pyridinyl)-(3,3-difluorocyclohexyl)methanol |
|---|---|
| PubChem CID | 114215752 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (2-amino-4-methyl-3-pyridinyl)-(3,3-difluorocyclohexyl)methanol |
| SMILES | Cc1ccnc(N)c1C(O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H18F2N2O/c1-8-4-6-17-12(16)10(8)11(18)9-3-2-5-13(14,15)7-9/h4,6,9,11,18H,2-3,5,7H2,1H3,(H2,16,17) |
| InChIKey | XEWCZJVPYNRWQX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |