C27H38N6O7 — CID 11421591
(3S)-5-iminoazaniumylidene-3-[[(2S)-2-[[(2S)-1-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-oxopentan-2-olate (PubChem CID 11421591) has the molecular formula C27H38N6O7 and a molecular weight of 558.64 g/mol. Its IUPAC name is (3S)-5-iminoazaniumylidene-3-[[(2S)-2-[[(2S)-1-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-oxopentan-2-olate.
| Compound Name | (3S)-5-iminoazaniumylidene-3-[[(2S)-2-[[(2S)-1-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-oxopentan-2-olate |
|---|---|
| PubChem CID | 11421591 |
| Molecular Formula | C27H38N6O7 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | (3S)-5-iminoazaniumylidene-3-[[(2S)-2-[[(2S)-1-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-oxopentan-2-olate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)C=[N+]=N)C(C)[O-] |
| InChI | InChI=1S/C27H38N6O7/c1-16(2)13-20(31-27(39)40-15-19-9-6-5-7-10-19)26(38)33-12-8-11-21(33)25(37)30-17(3)24(36)32-23(18(4)34)22(35)14-29-28/h5-7,9-10,14,16-18,20-21,23,28H,8,11-13,15H2,1-4H3,(H,30,37)(H,31,39)(H,32,36)/t17-,18?,20-,21-,23-/m0/s1 |
| InChIKey | CVPFPAXWQSHVJC-UHUHIZMPSA-N |
| XLogP | -0.06 |
| TPSA | 194.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|