C13H19F2NS — CID 114216048
N-[(3,3-difluorocyclohexyl)-thiophen-3-ylmethyl]ethanamine (PubChem CID 114216048) has the molecular formula C13H19F2NS and a molecular weight of 259.36 g/mol. Its IUPAC name is N-[(3,3-difluorocyclohexyl)-thiophen-3-ylmethyl]ethanamine.
| Compound Name | N-[(3,3-difluorocyclohexyl)-thiophen-3-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 114216048 |
| Molecular Formula | C13H19F2NS |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[(3,3-difluorocyclohexyl)-thiophen-3-ylmethyl]ethanamine |
| SMILES | CCNC(c1ccsc1)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H19F2NS/c1-2-16-12(11-5-7-17-9-11)10-4-3-6-13(14,15)8-10/h5,7,9-10,12,16H,2-4,6,8H2,1H3 |
| InChIKey | JLUZPRAFQDSYJK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |