C32H50O4SSi — CID 11421605
[(2S,6E,10E)-4-(benzenesulfonyl)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 11421605) has the molecular formula C32H50O4SSi and a molecular weight of 558.90 g/mol. Its IUPAC name is [(2S,6E,10E)-4-(benzenesulfonyl)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S,6E,10E)-4-(benzenesulfonyl)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11421605 |
| Molecular Formula | C32H50O4SSi |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | [(2S,6E,10E)-4-(benzenesulfonyl)-13-(furan-3-yl)-2,6,10-trimethyltrideca-6,10-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CC(C[C@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H50O4SSi/c1-26(15-13-17-29-20-21-35-25-29)14-12-16-27(2)22-31(37(33,34)30-18-10-9-11-19-30)23-28(3)24-36-38(7,8)32(4,5)6/h9-11,15-16,18-21,25,28,31H,12-14,17,22-24H2,1-8H3/b26-15+,27-16+/t28-,31?/m0/s1 |
| InChIKey | CZMVMIVSXLUURK-VZLDKNRUSA-N |
| XLogP | 9.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|