C32H35NO2S3 — CID 11421639
(E,3S)-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-tritylsulfanylhept-4-en-1-one (PubChem CID 11421639) has the molecular formula C32H35NO2S3 and a molecular weight of 561.84 g/mol. Its IUPAC name is (E,3S)-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-tritylsulfanylhept-4-en-1-one.
| Compound Name | (E,3S)-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-tritylsulfanylhept-4-en-1-one |
|---|---|
| PubChem CID | 11421639 |
| Molecular Formula | C32H35NO2S3 |
| Molecular Weight | 561.84 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (E,3S)-3-hydroxy-1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-tritylsulfanylhept-4-en-1-one |
| SMILES | CC(C)[C@@H]1CSC(=S)N1C(=O)C[C@H](O)/C=C/CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H35NO2S3/c1-24(2)29-23-37-31(36)33(29)30(35)22-28(34)20-12-13-21-38-32(25-14-6-3-7-15-25,26-16-8-4-9-17-26)27-18-10-5-11-19-27/h3-12,14-20,24,28-29,34H,13,21-23H2,1-2H3/b20-12+/t28-,29+/m1/s1 |
| InChIKey | AJTPUSQJWPQHSY-WGWPJPJGSA-N |
| XLogP | 7.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.84 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|