About 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile
4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile (PubChem CID 114216725) has the molecular formula C12H14F2N4
and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile |
| PubChem CID | 114216725 |
| Molecular Formula | C12H14F2N4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile |
| SMILES | Cc1nc(C2CCCC(F)(F)C2)nc(N)c1C#N |
| InChI | InChI=1S/C12H14F2N4/c1-7-9(6-15)10(16)18-11(17-7)8-3-2-4-12(13,14)5-8/h8H,2-5H2,1H3,(H2,16,17,18) |
| InChIKey | ZHQQSTRCFMUYLT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile?
The IUPAC name of 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile (CID 114216725) is 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile.
What is the SMILES notation for 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile?
The canonical SMILES for 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile is Cc1nc(C2CCCC(F)(F)C2)nc(N)c1C#N.
What is the InChIKey of 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile?
The InChIKey is ZHQQSTRCFMUYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N4/c1-7-9(6-15)10(16)18-11(17-7)8-3-2-4-12(13,14)5-8/h8H,2-5H2,1H3,(H2,16,17,18).
What are the key properties of 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile?
4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile has a molecular weight of 252.27 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(3,3-difluorocyclohexyl)-6-methylpyrimidine-5-carbonitrile is sourced from PubChem (CID 114216725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).