C11H14F2N2O2 — CID 114217039
2-(3,3-difluorocyclohexyl)-5-(hydroxymethyl)-1H-pyrimidin-6-one (PubChem CID 114217039) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-5-(hydroxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(3,3-difluorocyclohexyl)-5-(hydroxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114217039 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-5-(hydroxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CCCC(F)(F)C2)ncc1CO |
| InChI | InChI=1S/C11H14F2N2O2/c12-11(13)3-1-2-7(4-11)9-14-5-8(6-16)10(17)15-9/h5,7,16H,1-4,6H2,(H,14,15,17) |
| InChIKey | ZYHNFLXQMZOBIN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |