C11H11F2N3OS — CID 114217301
4-[3-(ethylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-3,5-difluoroaniline (PubChem CID 114217301) has the molecular formula C11H11F2N3OS and a molecular weight of 271.29 g/mol. Its IUPAC name is 4-[3-(ethylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-3,5-difluoroaniline.
| Compound Name | 4-[3-(ethylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 114217301 |
| Molecular Formula | C11H11F2N3OS |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 4-[3-(ethylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-3,5-difluoroaniline |
| SMILES | CCSCc1noc(-c2c(F)cc(N)cc2F)n1 |
| InChI | InChI=1S/C11H11F2N3OS/c1-2-18-5-9-15-11(17-16-9)10-7(12)3-6(14)4-8(10)13/h3-4H,2,5,14H2,1H3 |
| InChIKey | OFPXWDACCMZGPY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|