About [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine
[6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine (PubChem CID 114218872) has the molecular formula C12H19N5O3
and a molecular weight of 281.32 g/mol. Its IUPAC name is [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine |
| PubChem CID | 114218872 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine |
| SMILES | CCC1CN(c2cc([N+](=O)[O-])cc(NN)n2)CCCO1 |
| InChI | InChI=1S/C12H19N5O3/c1-2-10-8-16(4-3-5-20-10)12-7-9(17(18)19)6-11(14-12)15-13/h6-7,10H,2-5,8,13H2,1H3,(H,14,15) |
| InChIKey | HEWRQELIMXCNML-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine?
The IUPAC name of [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine (CID 114218872) is [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine.
What is the SMILES notation for [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine?
The canonical SMILES for [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine is CCC1CN(c2cc([N+](=O)[O-])cc(NN)n2)CCCO1.
What is the InChIKey of [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine?
The InChIKey is HEWRQELIMXCNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O3/c1-2-10-8-16(4-3-5-20-10)12-7-9(17(18)19)6-11(14-12)15-13/h6-7,10H,2-5,8,13H2,1H3,(H,14,15).
What are the key properties of [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine?
[6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine has a molecular weight of 281.32 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-ethyl-1,4-oxazepan-4-yl)-4-nitro-2-pyridinyl]hydrazine is sourced from PubChem (CID 114218872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).