C13H19N3O2 — CID 114218977
1-(1,5-dimethylpyrazole-3-carbonyl)-3-ethylpiperidin-4-one (PubChem CID 114218977) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazole-3-carbonyl)-3-ethylpiperidin-4-one.
| Compound Name | 1-(1,5-dimethylpyrazole-3-carbonyl)-3-ethylpiperidin-4-one |
|---|---|
| PubChem CID | 114218977 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(1,5-dimethylpyrazole-3-carbonyl)-3-ethylpiperidin-4-one |
| SMILES | CCC1CN(C(=O)c2cc(C)n(C)n2)CCC1=O |
| InChI | InChI=1S/C13H19N3O2/c1-4-10-8-16(6-5-12(10)17)13(18)11-7-9(2)15(3)14-11/h7,10H,4-6,8H2,1-3H3 |
| InChIKey | LXBPIQWWCVJLRR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |