C13H18N4O — CID 114220686
3-amino-2-(4-methoxy-2-methylpiperidin-1-yl)pyridine-4-carbonitrile (PubChem CID 114220686) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-amino-2-(4-methoxy-2-methylpiperidin-1-yl)pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-(4-methoxy-2-methylpiperidin-1-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114220686 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-amino-2-(4-methoxy-2-methylpiperidin-1-yl)pyridine-4-carbonitrile |
| SMILES | COC1CCN(c2nccc(C#N)c2N)C(C)C1 |
| InChI | InChI=1S/C13H18N4O/c1-9-7-11(18-2)4-6-17(9)13-12(15)10(8-14)3-5-16-13/h3,5,9,11H,4,6-7,15H2,1-2H3 |
| InChIKey | ILOZSASZTGATGI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |