C37H36ClF3N2O — CID 11422174
5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-dimethylnaphthalen-1-amine (PubChem CID 11422174) has the molecular formula C37H36ClF3N2O and a molecular weight of 617.16 g/mol. Its IUPAC name is 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 11422174 |
| Molecular Formula | C37H36ClF3N2O |
| Molecular Weight | 617.16 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-dimethylnaphthalen-1-amine |
| SMILES | CN(C)c1cccc2c(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)cccc12 |
| InChI | InChI=1S/C37H36ClF3N2O/c1-42(2)34-21-10-19-31-30(34)18-11-22-35(31)44-24-12-23-43(25-29-17-9-20-33(36(29)38)37(39,40)41)26-32(27-13-5-3-6-14-27)28-15-7-4-8-16-28/h3-11,13-22,32H,12,23-26H2,1-2H3 |
| InChIKey | JAKRFXJEHWOOQR-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.16 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|