C12H10BrF2N3 — CID 114222223
1-N-(5-bromo-3-pyridinyl)-2-(difluoromethyl)benzene-1,4-diamine (PubChem CID 114222223) has the molecular formula C12H10BrF2N3 and a molecular weight of 314.13 g/mol. Its IUPAC name is 1-N-(5-bromo-3-pyridinyl)-2-(difluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-(5-bromo-3-pyridinyl)-2-(difluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 114222223 |
| Molecular Formula | C12H10BrF2N3 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 1-N-(5-bromo-3-pyridinyl)-2-(difluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2cncc(Br)c2)c(C(F)F)c1 |
| InChI | InChI=1S/C12H10BrF2N3/c13-7-3-9(6-17-5-7)18-11-2-1-8(16)4-10(11)12(14)15/h1-6,12,18H,16H2 |
| InChIKey | OKASTLAUGCNEDZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|