C33H43F5O4S — CID 11422261
10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid (PubChem CID 11422261) has the molecular formula C33H43F5O4S and a molecular weight of 630.76 g/mol. Its IUPAC name is 10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid.
| Compound Name | 10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid |
|---|---|
| PubChem CID | 11422261 |
| Molecular Formula | C33H43F5O4S |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | 10-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid |
| SMILES | COc1ccc(C2(C)CSc3cc(OC)ccc3C2CCCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C33H43F5O4S/c1-31(24-14-16-25(41-2)17-15-24)22-43-29-21-26(42-3)18-19-27(29)28(31)13-9-7-5-4-6-8-11-23(30(39)40)12-10-20-32(34,35)33(36,37)38/h14-19,21,23,28H,4-13,20,22H2,1-3H3,(H,39,40) |
| InChIKey | KTNOUIGCZVQUPI-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|