C13H12BrN3 — CID 114223014
2-(5-bromo-3-pyridinyl)-1,3-dihydroisoindol-4-amine (PubChem CID 114223014) has the molecular formula C13H12BrN3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 114223014 |
| Molecular Formula | C13H12BrN3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1,3-dihydroisoindol-4-amine |
| SMILES | Nc1cccc2c1CN(c1cncc(Br)c1)C2 |
| InChI | InChI=1S/C13H12BrN3/c14-10-4-11(6-16-5-10)17-7-9-2-1-3-13(15)12(9)8-17/h1-6H,7-8,15H2 |
| InChIKey | VXHRELBXANRPJD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|