About CID 11422349
CID 11422349 (PubChem CID 11422349) has the molecular formula C24H32BiCl2N2O
and a molecular weight of 644.42 g/mol.
Molecular Properties
| Compound Name | CID 11422349 |
| PubChem CID | 11422349 |
| Molecular Formula | C24H32BiCl2N2O |
| Molecular Weight | 644.42 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | — |
| SMILES | C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C9H16N2.C8H9O.C7H7.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-7-4-3-5-8(6-7)9-2;1-7-5-3-2-4-6-7;;;/h1-8H2;3,5-6H,1-2H3;2-5H,1H3;;2*1H/q;;;+2;;/p-2 |
| InChIKey | HXMJVHKCJFDZQM-UHFFFAOYSA-L |
| XLogP | 5.01 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 11422349 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11422349?
The IUPAC name of CID 11422349 (CID 11422349) is not available.
What is the SMILES notation for CID 11422349?
The canonical SMILES for CID 11422349 is C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccccc2C)c(C)c1.
What is the InChIKey of CID 11422349?
The InChIKey is HXMJVHKCJFDZQM-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H16N2.C8H9O.C7H7.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-7-4-3-5-8(6-7)9-2;1-7-5-3-2-4-6-7;;;/h1-8H2;3,5-6H,1-2H3;2-5H,1H3;;2*1H/q;;;+2;;/p-2.
What are the key properties of CID 11422349?
CID 11422349 has a molecular weight of 644.42 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11422349 is sourced from PubChem (CID 11422349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).