About N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline
N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline (PubChem CID 114223721) has the molecular formula C13H16F3N
and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline |
| PubChem CID | 114223721 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline |
| SMILES | Cc1cc(F)ccc1NCC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H16F3N/c1-9-6-11(14)2-3-12(9)17-8-10-4-5-13(15,16)7-10/h2-3,6,10,17H,4-5,7-8H2,1H3 |
| InChIKey | MHDUEGMZUAFEJV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline?
The IUPAC name of N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline (CID 114223721) is N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline.
What is the SMILES notation for N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline?
The canonical SMILES for N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline is Cc1cc(F)ccc1NCC1CCC(F)(F)C1.
What is the InChIKey of N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline?
The InChIKey is MHDUEGMZUAFEJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N/c1-9-6-11(14)2-3-12(9)17-8-10-4-5-13(15,16)7-10/h2-3,6,10,17H,4-5,7-8H2,1H3.
What are the key properties of N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline?
N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline has a molecular weight of 243.27 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclopentyl)methyl]-4-fluoro-2-methylaniline is sourced from PubChem (CID 114223721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).