About N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine
N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine (PubChem CID 114223765) has the molecular formula C13H21F2N3
and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine |
| PubChem CID | 114223765 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine |
| SMILES | CC(Cn1cccn1)NCC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H21F2N3/c1-11(10-18-7-3-6-17-18)16-9-12-4-2-5-13(14,15)8-12/h3,6-7,11-12,16H,2,4-5,8-10H2,1H3 |
| InChIKey | VNXVJVDPSORQMT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine?
The IUPAC name of N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine (CID 114223765) is N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine.
What is the SMILES notation for N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine?
The canonical SMILES for N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine is CC(Cn1cccn1)NCC1CCCC(F)(F)C1.
What is the InChIKey of N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine?
The InChIKey is VNXVJVDPSORQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F2N3/c1-11(10-18-7-3-6-17-18)16-9-12-4-2-5-13(14,15)8-12/h3,6-7,11-12,16H,2,4-5,8-10H2,1H3.
What are the key properties of N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine?
N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine has a molecular weight of 257.33 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclohexyl)methyl]-1-pyrazol-1-ylpropan-2-amine is sourced from PubChem (CID 114223765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).