C13H24F2N2O — CID 114223914
N-tert-butyl-3-[(3,3-difluorocyclopentyl)methylamino]propanamide (PubChem CID 114223914) has the molecular formula C13H24F2N2O and a molecular weight of 262.34 g/mol. Its IUPAC name is N-tert-butyl-3-[(3,3-difluorocyclopentyl)methylamino]propanamide.
| Compound Name | N-tert-butyl-3-[(3,3-difluorocyclopentyl)methylamino]propanamide |
|---|---|
| PubChem CID | 114223914 |
| Molecular Formula | C13H24F2N2O |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N-tert-butyl-3-[(3,3-difluorocyclopentyl)methylamino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCNCC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H24F2N2O/c1-12(2,3)17-11(18)5-7-16-9-10-4-6-13(14,15)8-10/h10,16H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | XXIUIWPGCCKVDO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|