About 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine
2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine (PubChem CID 114224266) has the molecular formula C14H25F2NO
and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine.
Molecular Properties
| Compound Name | 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine |
| PubChem CID | 114224266 |
| Molecular Formula | C14H25F2NO |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine |
| SMILES | FC1(F)CCCC(COCCC2CCCCN2)C1 |
| InChI | InChI=1S/C14H25F2NO/c15-14(16)7-3-4-12(10-14)11-18-9-6-13-5-1-2-8-17-13/h12-13,17H,1-11H2 |
| InChIKey | YILBLMKVUZXAIX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine?
The IUPAC name of 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine (CID 114224266) is 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine.
What is the SMILES notation for 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine?
The canonical SMILES for 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine is FC1(F)CCCC(COCCC2CCCCN2)C1.
What is the InChIKey of 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine?
The InChIKey is YILBLMKVUZXAIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NO/c15-14(16)7-3-4-12(10-14)11-18-9-6-13-5-1-2-8-17-13/h12-13,17H,1-11H2.
What are the key properties of 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine?
2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine has a molecular weight of 261.36 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3,3-difluorocyclohexyl)methoxy]ethyl]piperidine is sourced from PubChem (CID 114224266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).