C13H21F2NO3 — CID 114224344
2-[4-[(3,3-difluorocyclohexyl)methyl]morpholin-2-yl]acetic acid (PubChem CID 114224344) has the molecular formula C13H21F2NO3 and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[4-[(3,3-difluorocyclohexyl)methyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[(3,3-difluorocyclohexyl)methyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 114224344 |
| Molecular Formula | C13H21F2NO3 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[4-[(3,3-difluorocyclohexyl)methyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(CC2CCCC(F)(F)C2)CCO1 |
| InChI | InChI=1S/C13H21F2NO3/c14-13(15)3-1-2-10(7-13)8-16-4-5-19-11(9-16)6-12(17)18/h10-11H,1-9H2,(H,17,18) |
| InChIKey | OHOYDUDELNMRFH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |