C28H33F3N2O13 — CID 11422447
methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 11422447) has the molecular formula C28H33F3N2O13 and a molecular weight of 662.57 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11422447 |
| Molecular Formula | C28H33F3N2O13 |
| Molecular Weight | 662.57 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(O/C(=N/c2ccccc2)C(F)(F)F)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C28H33F3N2O13/c1-14(34)32-22-20(42-16(3)36)12-27(26(39)40-6,46-25(28(29,30)31)33-19-10-8-7-9-11-19)45-24(22)23(44-18(5)38)21(43-17(4)37)13-41-15(2)35/h7-11,20-24H,12-13H2,1-6H3,(H,32,34)/b33-25+/t20-,21+,22+,23+,24+,27-/m0/s1 |
| InChIKey | DXTDONNXMSROFM-JCBYRKFASA-N |
| XLogP | 1.82 |
| TPSA | 191.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.57 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|