C12H18F2N2O — CID 114224502
2-(3,3-difluorocyclohexyl)-1-(3-methylimidazol-4-yl)ethanol (PubChem CID 114224502) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-1-(3-methylimidazol-4-yl)ethanol.
| Compound Name | 2-(3,3-difluorocyclohexyl)-1-(3-methylimidazol-4-yl)ethanol |
|---|---|
| PubChem CID | 114224502 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-1-(3-methylimidazol-4-yl)ethanol |
| SMILES | Cn1cncc1C(O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H18F2N2O/c1-16-8-15-7-10(16)11(17)5-9-3-2-4-12(13,14)6-9/h7-9,11,17H,2-6H2,1H3 |
| InChIKey | KZJFGMPCYZLMNG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |