About 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol
3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol (PubChem CID 114224507) has the molecular formula C13H22F2OS
and a molecular weight of 264.38 g/mol. Its IUPAC name is 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol.
Molecular Properties
| Compound Name | 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol |
| PubChem CID | 114224507 |
| Molecular Formula | C13H22F2OS |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol |
| SMILES | CC1(C)CCSCC1(O)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H22F2OS/c1-11(2)5-6-17-9-12(11,16)7-10-3-4-13(14,15)8-10/h10,16H,3-9H2,1-2H3 |
| InChIKey | IATWYFXQWVZDJU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol?
The IUPAC name of 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol (CID 114224507) is 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol.
What is the SMILES notation for 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol?
The canonical SMILES for 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol is CC1(C)CCSCC1(O)CC1CCC(F)(F)C1.
What is the InChIKey of 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol?
The InChIKey is IATWYFXQWVZDJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F2OS/c1-11(2)5-6-17-9-12(11,16)7-10-3-4-13(14,15)8-10/h10,16H,3-9H2,1-2H3.
What are the key properties of 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol?
3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol has a molecular weight of 264.38 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,3-difluorocyclopentyl)methyl]-4,4-dimethylthian-3-ol is sourced from PubChem (CID 114224507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).