About 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol
4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol (PubChem CID 114224516) has the molecular formula C13H23F2NO
and a molecular weight of 247.33 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol |
| PubChem CID | 114224516 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol |
| SMILES | CC1CC(O)(CC2CCC(F)(F)C2)CCN1C |
| InChI | InChI=1S/C13H23F2NO/c1-10-7-12(17,5-6-16(10)2)8-11-3-4-13(14,15)9-11/h10-11,17H,3-9H2,1-2H3 |
| InChIKey | QIVBYHCJUROCQB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol?
The IUPAC name of 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol (CID 114224516) is 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol.
What is the SMILES notation for 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol?
The canonical SMILES for 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol is CC1CC(O)(CC2CCC(F)(F)C2)CCN1C.
What is the InChIKey of 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol?
The InChIKey is QIVBYHCJUROCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F2NO/c1-10-7-12(17,5-6-16(10)2)8-11-3-4-13(14,15)9-11/h10-11,17H,3-9H2,1-2H3.
What are the key properties of 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol?
4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol has a molecular weight of 247.33 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,3-difluorocyclopentyl)methyl]-1,2-dimethylpiperidin-4-ol is sourced from PubChem (CID 114224516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).