About 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine
1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine (PubChem CID 114224874) has the molecular formula C13H25F2NO
and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine |
| PubChem CID | 114224874 |
| Molecular Formula | C13H25F2NO |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine |
| SMILES | CNC(CC1CCCC(F)(F)C1)C(C)(C)OC |
| InChI | InChI=1S/C13H25F2NO/c1-12(2,17-4)11(16-3)8-10-6-5-7-13(14,15)9-10/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | QCVNHBAMRKDWLP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine?
The IUPAC name of 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine (CID 114224874) is 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine.
What is the SMILES notation for 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine?
The canonical SMILES for 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine is CNC(CC1CCCC(F)(F)C1)C(C)(C)OC.
What is the InChIKey of 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine?
The InChIKey is QCVNHBAMRKDWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F2NO/c1-12(2,17-4)11(16-3)8-10-6-5-7-13(14,15)9-10/h10-11,16H,5-9H2,1-4H3.
What are the key properties of 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine?
1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine has a molecular weight of 249.34 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluorocyclohexyl)-3-methoxy-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 114224874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).