C13H25F2NO2 — CID 114224956
1-(3,3-difluorocyclopentyl)-4-(2-methoxyethoxy)-N-methylbutan-2-amine (PubChem CID 114224956) has the molecular formula C13H25F2NO2 and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)-4-(2-methoxyethoxy)-N-methylbutan-2-amine.
| Compound Name | 1-(3,3-difluorocyclopentyl)-4-(2-methoxyethoxy)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 114224956 |
| Molecular Formula | C13H25F2NO2 |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)-4-(2-methoxyethoxy)-N-methylbutan-2-amine |
| SMILES | CNC(CCOCCOC)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H25F2NO2/c1-16-12(4-6-18-8-7-17-2)9-11-3-5-13(14,15)10-11/h11-12,16H,3-10H2,1-2H3 |
| InChIKey | ODNBYAJKLLVPJS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|