C12H15F2IN2O — CID 114224991
3-[(3,3-difluorocyclohexyl)methyl]-5-iodo-2-methylpyrimidin-4-one (PubChem CID 114224991) has the molecular formula C12H15F2IN2O and a molecular weight of 368.17 g/mol. Its IUPAC name is 3-[(3,3-difluorocyclohexyl)methyl]-5-iodo-2-methylpyrimidin-4-one.
| Compound Name | 3-[(3,3-difluorocyclohexyl)methyl]-5-iodo-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 114224991 |
| Molecular Formula | C12H15F2IN2O |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 3-[(3,3-difluorocyclohexyl)methyl]-5-iodo-2-methylpyrimidin-4-one |
| SMILES | Cc1ncc(I)c(=O)n1CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H15F2IN2O/c1-8-16-6-10(15)11(18)17(8)7-9-3-2-4-12(13,14)5-9/h6,9H,2-5,7H2,1H3 |
| InChIKey | LKXFPUKEYCKJFW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|