C15H25ClF2 — CID 114225016
1-chloro-2-[(3,3-difluorocyclopentyl)methyl]-4-propan-2-ylcyclohexane (PubChem CID 114225016) has the molecular formula C15H25ClF2 and a molecular weight of 278.81 g/mol. Its IUPAC name is 1-chloro-2-[(3,3-difluorocyclopentyl)methyl]-4-propan-2-ylcyclohexane.
| Compound Name | 1-chloro-2-[(3,3-difluorocyclopentyl)methyl]-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 114225016 |
| Molecular Formula | C15H25ClF2 |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-chloro-2-[(3,3-difluorocyclopentyl)methyl]-4-propan-2-ylcyclohexane |
| SMILES | CC(C)C1CCC(Cl)C(CC2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C15H25ClF2/c1-10(2)12-3-4-14(16)13(8-12)7-11-5-6-15(17,18)9-11/h10-14H,3-9H2,1-2H3 |
| InChIKey | PDWXWCOCKKWJDB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|