About ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate
ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate (PubChem CID 114225024) has the molecular formula C14H23F2NO2
and a molecular weight of 275.34 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate |
| PubChem CID | 114225024 |
| Molecular Formula | C14H23F2NO2 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC1CCCC(F)(F)C1)C1CC1 |
| InChI | InChI=1S/C14H23F2NO2/c1-2-19-13(18)10-17(12-5-6-12)9-11-4-3-7-14(15,16)8-11/h11-12H,2-10H2,1H3 |
| InChIKey | RHMXLNPPYNUOLJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate?
The IUPAC name of ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate (CID 114225024) is ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate.
What is the SMILES notation for ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate?
The canonical SMILES for ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate is CCOC(=O)CN(CC1CCCC(F)(F)C1)C1CC1.
What is the InChIKey of ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate?
The InChIKey is RHMXLNPPYNUOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F2NO2/c1-2-19-13(18)10-17(12-5-6-12)9-11-4-3-7-14(15,16)8-11/h11-12H,2-10H2,1H3.
What are the key properties of ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate?
ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate has a molecular weight of 275.34 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[cyclopropyl-[(3,3-difluorocyclohexyl)methyl]amino]acetate is sourced from PubChem (CID 114225024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).