About 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol
2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol (PubChem CID 114225086) has the molecular formula C11H17F2N3O
and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol |
| PubChem CID | 114225086 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cn(CC2CCC(F)(F)C2)nn1 |
| InChI | InChI=1S/C11H17F2N3O/c1-10(2,17)9-7-16(15-14-9)6-8-3-4-11(12,13)5-8/h7-8,17H,3-6H2,1-2H3 |
| InChIKey | GYCPNQFRDBOIET-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol?
The IUPAC name of 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol (CID 114225086) is 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol.
What is the SMILES notation for 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol?
The canonical SMILES for 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol is CC(C)(O)c1cn(CC2CCC(F)(F)C2)nn1.
What is the InChIKey of 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol?
The InChIKey is GYCPNQFRDBOIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3O/c1-10(2,17)9-7-16(15-14-9)6-8-3-4-11(12,13)5-8/h7-8,17H,3-6H2,1-2H3.
What are the key properties of 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol?
2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol has a molecular weight of 245.27 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(3,3-difluorocyclopentyl)methyl]triazol-4-yl]propan-2-ol is sourced from PubChem (CID 114225086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).