About 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine
6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine (PubChem CID 114225213) has the molecular formula C14H24BrF2NO
and a molecular weight of 340.25 g/mol. Its IUPAC name is 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine |
| PubChem CID | 114225213 |
| Molecular Formula | C14H24BrF2NO |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(CC2CCCC(F)(F)C2)CC(CBr)O1 |
| InChI | InChI=1S/C14H24BrF2NO/c1-13(2)10-18(9-12(7-15)19-13)8-11-4-3-5-14(16,17)6-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | JHMBSFZQTJRYFP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine?
The IUPAC name of 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine (CID 114225213) is 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine.
What is the SMILES notation for 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine?
The canonical SMILES for 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine is CC1(C)CN(CC2CCCC(F)(F)C2)CC(CBr)O1.
What is the InChIKey of 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine?
The InChIKey is JHMBSFZQTJRYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24BrF2NO/c1-13(2)10-18(9-12(7-15)19-13)8-11-4-3-5-14(16,17)6-11/h11-12H,3-10H2,1-2H3.
What are the key properties of 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine?
6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine has a molecular weight of 340.25 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)-4-[(3,3-difluorocyclohexyl)methyl]-2,2-dimethylmorpholine is sourced from PubChem (CID 114225213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).