About N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine
N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine (PubChem CID 114225272) has the molecular formula C13H21F2N3
and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine |
| PubChem CID | 114225272 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cnn(CC2CCC(F)(F)C2)c1C |
| InChI | InChI=1S/C13H21F2N3/c1-3-16-7-12-8-17-18(10(12)2)9-11-4-5-13(14,15)6-11/h8,11,16H,3-7,9H2,1-2H3 |
| InChIKey | SGQOOGIGZDUMPQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine?
The IUPAC name of N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine (CID 114225272) is N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine.
What is the SMILES notation for N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine?
The canonical SMILES for N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine is CCNCc1cnn(CC2CCC(F)(F)C2)c1C.
What is the InChIKey of N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine?
The InChIKey is SGQOOGIGZDUMPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F2N3/c1-3-16-7-12-8-17-18(10(12)2)9-11-4-5-13(14,15)6-11/h8,11,16H,3-7,9H2,1-2H3.
What are the key properties of N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine?
N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine has a molecular weight of 257.33 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(3,3-difluorocyclopentyl)methyl]-5-methylpyrazol-4-yl]methyl]ethanamine is sourced from PubChem (CID 114225272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).