C40H64O5Si2 — CID 11422536
tert-butyl-[(1S,2R,3R,4S)-3-[(1S)-2-ethoxy-1-triethylsilyloxyprop-2-enyl]-4-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]oxy-diphenylsilane (PubChem CID 11422536) has the molecular formula C40H64O5Si2 and a molecular weight of 681.12 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,3R,4S)-3-[(1S)-2-ethoxy-1-triethylsilyloxyprop-2-enyl]-4-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(1S,2R,3R,4S)-3-[(1S)-2-ethoxy-1-triethylsilyloxyprop-2-enyl]-4-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11422536 |
| Molecular Formula | C40H64O5Si2 |
| Molecular Weight | 681.12 g/mol |
| Exact Mass | 680.43 |
| IUPAC Name | tert-butyl-[(1S,2R,3R,4S)-3-[(1S)-2-ethoxy-1-triethylsilyloxyprop-2-enyl]-4-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]oxy-diphenylsilane |
| SMILES | C=CC[C@](C)(OCOC)[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)[C@H]1[C@H](O[Si](CC)(CC)CC)C(=C)OCC |
| InChI | InChI=1S/C40H64O5Si2/c1-13-28-40(11,43-30-41-12)35-29-36(31(6)37(35)38(32(7)42-14-2)45-46(15-3,16-4)17-5)44-47(39(8,9)10,33-24-20-18-21-25-33)34-26-22-19-23-27-34/h13,18-27,31,35-38H,1,7,14-17,28-30H2,2-6,8-12H3/t31-,35-,36-,37+,38+,40-/m0/s1 |
| InChIKey | OERVSLBWDWYRLM-CSEINDJRSA-N |
| XLogP | 9.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.12 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|