C42H58N4O4 — CID 11422540
2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]-5-methylisoindole-1,3-dione (PubChem CID 11422540) has the molecular formula C42H58N4O4 and a molecular weight of 682.95 g/mol. Its IUPAC name is 2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]-5-methylisoindole-1,3-dione.
| Compound Name | 2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 11422540 |
| Molecular Formula | C42H58N4O4 |
| Molecular Weight | 682.95 g/mol |
| Exact Mass | 682.45 |
| IUPAC Name | 2-[3-[cyclohexyl-[6-[cyclohexyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]amino]hexyl]amino]propyl]-5-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCN(CCCCCCN(CCCN1C(=O)c3ccc(C)cc3C1=O)C1CCCCC1)C1CCCCC1)C2=O |
| InChI | InChI=1S/C42H58N4O4/c1-31-19-21-35-37(29-31)41(49)45(39(35)47)27-13-25-43(33-15-7-5-8-16-33)23-11-3-4-12-24-44(34-17-9-6-10-18-34)26-14-28-46-40(48)36-22-20-32(2)30-38(36)42(46)50/h19-22,29-30,33-34H,3-18,23-28H2,1-2H3 |
| InChIKey | AJIVYRHHGKFSDJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.95 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|