About (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine
(Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine (PubChem CID 114225479) has the molecular formula C14H25F2N
and a molecular weight of 245.36 g/mol. Its IUPAC name is (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine.
Molecular Properties
| Compound Name | (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine |
| PubChem CID | 114225479 |
| Molecular Formula | C14H25F2N |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine |
| SMILES | CCCNCC/C=C(/C)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H25F2N/c1-3-8-17-9-4-5-12(2)10-13-6-7-14(15,16)11-13/h5,13,17H,3-4,6-11H2,1-2H3/b12-5- |
| InChIKey | IZJLIUBPBMROMP-XGICHPGQSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine?
The IUPAC name of (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine (CID 114225479) is (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine.
What is the SMILES notation for (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine?
The canonical SMILES for (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine is CCCNCC/C=C(/C)CC1CCC(F)(F)C1.
What is the InChIKey of (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine?
The InChIKey is IZJLIUBPBMROMP-XGICHPGQSA-N. The full InChI is InChI=1S/C14H25F2N/c1-3-8-17-9-4-5-12(2)10-13-6-7-14(15,16)11-13/h5,13,17H,3-4,6-11H2,1-2H3/b12-5-.
What are the key properties of (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine?
(Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine has a molecular weight of 245.36 g/mol, XLogP of 4.15, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-(3,3-difluorocyclopentyl)-4-methyl-N-propylpent-3-en-1-amine is sourced from PubChem (CID 114225479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).