C13H23F2NO — CID 114225487
5-(3,3-difluorocyclohexyl)-4-(methoxymethyl)pent-4-en-1-amine (PubChem CID 114225487) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is 5-(3,3-difluorocyclohexyl)-4-(methoxymethyl)pent-4-en-1-amine.
| Compound Name | 5-(3,3-difluorocyclohexyl)-4-(methoxymethyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 114225487 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 5-(3,3-difluorocyclohexyl)-4-(methoxymethyl)pent-4-en-1-amine |
| SMILES | COCC(=CC1CCCC(F)(F)C1)CCCN |
| InChI | InChI=1S/C13H23F2NO/c1-17-10-12(5-3-7-16)8-11-4-2-6-13(14,15)9-11/h8,11H,2-7,9-10,16H2,1H3 |
| InChIKey | UMEXIKYUNRSXDG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|