C13H21F2NO2 — CID 114225587
1-(3,3-difluorocyclohexyl)-3-morpholin-3-ylpropan-2-one (PubChem CID 114225587) has the molecular formula C13H21F2NO2 and a molecular weight of 261.31 g/mol. Its IUPAC name is 1-(3,3-difluorocyclohexyl)-3-morpholin-3-ylpropan-2-one.
| Compound Name | 1-(3,3-difluorocyclohexyl)-3-morpholin-3-ylpropan-2-one |
|---|---|
| PubChem CID | 114225587 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(3,3-difluorocyclohexyl)-3-morpholin-3-ylpropan-2-one |
| SMILES | O=C(CC1CCCC(F)(F)C1)CC1COCCN1 |
| InChI | InChI=1S/C13H21F2NO2/c14-13(15)3-1-2-10(8-13)6-12(17)7-11-9-18-5-4-16-11/h10-11,16H,1-9H2 |
| InChIKey | WEOQHCWUFSKIOE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |